C25H27N3O4S — CID 126177508
(5E)-3-ethyl-5-[(4-methoxy-2-methylphenyl)methylidene]-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126177508) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[(4-methoxy-2-methylphenyl)methylidene]-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[(4-methoxy-2-methylphenyl)methylidene]-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126177508 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (5E)-3-ethyl-5-[(4-methoxy-2-methylphenyl)methylidene]-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OC)cc2C)S/C1=N\c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H27N3O4S/c1-4-28-24(30)22(16-18-8-9-21(31-3)14-17(18)2)33-25(28)26-20-7-5-6-19(15-20)23(29)27-10-12-32-13-11-27/h5-9,14-16H,4,10-13H2,1-3H3/b22-16+,26-25- |
| InChIKey | YVLSJZZAWLSCHA-HNEFAFEWSA-N |
| XLogP | 4.10 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|