C26H29N3O5S — CID 126166781
(5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126166781) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is (5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126166781 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (5E)-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1c(/C=C2/S/C(=N\c3cccc(C(=O)N4CCOCC4)c3)N(CC)C2=O)cccc1OC |
| InChI | InChI=1S/C26H29N3O5S/c1-4-29-25(31)22(17-18-8-7-11-21(32-3)23(18)34-5-2)35-26(29)27-20-10-6-9-19(16-20)24(30)28-12-14-33-15-13-28/h6-11,16-17H,4-5,12-15H2,1-3H3/b22-17+,27-26- |
| InChIKey | QLRZAXTZHVOSLZ-DKCMOLDMSA-N |
| XLogP | 4.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|