C25H26BrN3O5S — CID 126177432
(5E)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126177432) has the molecular formula C25H26BrN3O5S and a molecular weight of 560.47 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126177432 |
| Molecular Formula | C25H26BrN3O5S |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | (5E)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1c(Br)cc(/C=C2/S/C(=N\c3cccc(C(=O)N4CCOCC4)c3)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C25H26BrN3O5S/c1-4-34-22-19(26)12-16(13-20(22)32-3)14-21-24(31)28(2)25(35-21)27-18-7-5-6-17(15-18)23(30)29-8-10-33-11-9-29/h5-7,12-15H,4,8-11H2,1-3H3/b21-14+,27-25- |
| InChIKey | YHHUWNFOVZTFGI-SRVANGTOSA-N |
| XLogP | 4.56 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|