C26H29N3O4S — CID 126173685
(5E)-5-[(4-butoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126173685) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is (5E)-5-[(4-butoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-butoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126173685 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (5E)-5-[(4-butoxyphenyl)methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccc(/C=C2/S/C(=N/c3cccc(C(=O)N4CCOCC4)c3)N(C)C2=O)cc1 |
| InChI | InChI=1S/C26H29N3O4S/c1-3-4-14-33-22-10-8-19(9-11-22)17-23-25(31)28(2)26(34-23)27-21-7-5-6-20(18-21)24(30)29-12-15-32-16-13-29/h5-11,17-18H,3-4,12-16H2,1-2H3/b23-17+,27-26+ |
| InChIKey | IPOVQLMOUXJIQR-TVBXNAKKSA-N |
| XLogP | 4.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|