C23H23N3O2S — CID 9485519
(5E)-5-benzylidene-3-methyl-2-[3-(piperidine-1-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 9485519) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-methyl-2-[3-(piperidine-1-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-benzylidene-3-methyl-2-[3-(piperidine-1-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9485519 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (5E)-5-benzylidene-3-methyl-2-[3-(piperidine-1-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccccc2)S/C1=N/c1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H23N3O2S/c1-25-22(28)20(15-17-9-4-2-5-10-17)29-23(25)24-19-12-8-11-18(16-19)21(27)26-13-6-3-7-14-26/h2,4-5,8-12,15-16H,3,6-7,13-14H2,1H3/b20-15+,24-23+ |
| InChIKey | WGQGNPQJESNTOC-WYPBWKFOSA-N |
| XLogP | 4.55 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|