C21H20N2O3S — CID 9485455
propan-2-yl 3-[[(5E)-5-benzylidene-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 9485455) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is propan-2-yl 3-[[(5E)-5-benzylidene-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | propan-2-yl 3-[[(5E)-5-benzylidene-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 9485455 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | propan-2-yl 3-[[(5E)-5-benzylidene-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(/N=C2/S/C(=C/c3ccccc3)C(=O)N2C)c1 |
| InChI | InChI=1S/C21H20N2O3S/c1-14(2)26-20(25)16-10-7-11-17(13-16)22-21-23(3)19(24)18(27-21)12-15-8-5-4-6-9-15/h4-14H,1-3H3/b18-12+,22-21+ |
| InChIKey | ZXYXMPULTCLAKN-QLHXNQQISA-N |
| XLogP | 4.49 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|