C26H22N2O4S — CID 3690645
methyl 3-[[3-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3690645) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is methyl 3-[[3-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[3-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3690645 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | methyl 3-[[3-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1cccc(/N=C2\SC(=Cc3ccc(OCc4ccccc4)cc3)C(=O)N2C)c1 |
| InChI | InChI=1S/C26H22N2O4S/c1-28-24(29)23(33-26(28)27-21-10-6-9-20(16-21)25(30)31-2)15-18-11-13-22(14-12-18)32-17-19-7-4-3-5-8-19/h3-16H,17H2,1-2H3/b23-15?,27-26- |
| InChIKey | COABKAXYWWEIEM-REZWCUHSSA-N |
| XLogP | 5.29 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|