C26H20Cl2N2O4S — CID 3353155
methyl 3-[[5-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3353155) has the molecular formula C26H20Cl2N2O4S and a molecular weight of 527.43 g/mol. Its IUPAC name is methyl 3-[[5-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[5-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3353155 |
| Molecular Formula | C26H20Cl2N2O4S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | methyl 3-[[5-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1cccc(/N=C2\SC(=Cc3cc(Cl)ccc3OCc3cccc(Cl)c3)C(=O)N2C)c1 |
| InChI | InChI=1S/C26H20Cl2N2O4S/c1-30-24(31)23(35-26(30)29-21-8-4-6-17(13-21)25(32)33-2)14-18-12-20(28)9-10-22(18)34-15-16-5-3-7-19(27)11-16/h3-14H,15H2,1-2H3/b23-14?,29-26- |
| InChIKey | OPULPUSOCAXIGX-OIGNSQSESA-N |
| XLogP | 6.59 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|