C26H19BrCl2N2O4S — CID 4765206
methyl 4-[[5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4765206) has the molecular formula C26H19BrCl2N2O4S and a molecular weight of 606.33 g/mol. Its IUPAC name is methyl 4-[[5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4765206 |
| Molecular Formula | C26H19BrCl2N2O4S |
| Molecular Weight | 606.33 g/mol |
| Exact Mass | 603.96 |
| IUPAC Name | methyl 4-[[5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C2\SC(=Cc3cc(Br)ccc3OCc3ccc(Cl)cc3Cl)C(=O)N2C)cc1 |
| InChI | InChI=1S/C26H19BrCl2N2O4S/c1-31-24(32)23(36-26(31)30-20-8-4-15(5-9-20)25(33)34-2)12-17-11-18(27)6-10-22(17)35-14-16-3-7-19(28)13-21(16)29/h3-13H,14H2,1-2H3/b23-12?,30-26- |
| InChIKey | UDDCFBOALPGKRV-NPGWAKLFSA-N |
| XLogP | 7.36 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.33 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|