C25H16Br2Cl2N2O4S — CID 4772051
4-[[5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4772051) has the molecular formula C25H16Br2Cl2N2O4S and a molecular weight of 671.19 g/mol. Its IUPAC name is 4-[[5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4772051 |
| Molecular Formula | C25H16Br2Cl2N2O4S |
| Molecular Weight | 671.19 g/mol |
| Exact Mass | 667.86 |
| IUPAC Name | 4-[[5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CN1C(=O)C(=Cc2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c2)S/C1=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H16Br2Cl2N2O4S/c1-31-23(32)21(36-25(31)30-17-6-3-14(4-7-17)24(33)34)10-13-8-18(26)22(19(27)9-13)35-12-15-2-5-16(28)11-20(15)29/h2-11H,12H2,1H3,(H,33,34)/b21-10?,30-25+ |
| InChIKey | NKLLOLXZZDIOAQ-IELSRALVSA-N |
| XLogP | 8.03 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.19 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|