C26H20BrN3O6S — CID 21228355
methyl 4-[[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 21228355) has the molecular formula C26H20BrN3O6S and a molecular weight of 582.43 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 21228355 |
| Molecular Formula | C26H20BrN3O6S |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | methyl 4-[[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C2/S/C(=C\c3cc(Br)ccc3OCc3ccc([N+](=O)[O-])cc3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C26H20BrN3O6S/c1-29-24(31)23(37-26(29)28-20-8-5-17(6-9-20)25(32)35-2)14-18-13-19(27)7-12-22(18)36-15-16-3-10-21(11-4-16)30(33)34/h3-14H,15H2,1-2H3/b23-14-,28-26+ |
| InChIKey | JSUNBQQEDANVBE-LUAXBZEPSA-N |
| XLogP | 5.96 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|