C25H18BrN3O6S — CID 4772159
3-[[5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4772159) has the molecular formula C25H18BrN3O6S and a molecular weight of 568.41 g/mol. Its IUPAC name is 3-[[5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4772159 |
| Molecular Formula | C25H18BrN3O6S |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 567.01 |
| IUPAC Name | 3-[[5-[[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CN1C(=O)C(=Cc2ccc(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18BrN3O6S/c1-28-23(30)22(36-25(28)27-18-4-2-3-17(13-18)24(31)32)12-16-7-10-21(20(26)11-16)35-14-15-5-8-19(9-6-15)29(33)34/h2-13H,14H2,1H3,(H,31,32)/b22-12?,27-25- |
| InChIKey | PIMKALPBWDZFSG-UVXMEFQMSA-N |
| XLogP | 5.87 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|