C25H18BrClN2O4S — CID 21227953
3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21227953) has the molecular formula C25H18BrClN2O4S and a molecular weight of 557.85 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21227953 |
| Molecular Formula | C25H18BrClN2O4S |
| Molecular Weight | 557.85 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | 3-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CN1C(=O)/C(=C/c2ccc(OCc3ccc(Br)cc3)c(Cl)c2)S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18BrClN2O4S/c1-29-23(30)22(34-25(29)28-19-4-2-3-17(13-19)24(31)32)12-16-7-10-21(20(27)11-16)33-14-15-5-8-18(26)9-6-15/h2-13H,14H2,1H3,(H,31,32)/b22-12-,28-25+ |
| InChIKey | OQSSTHNUECSBBQ-NWNLVDRJSA-N |
| XLogP | 6.61 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.85 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|