C25H17BrCl2N2O4S — CID 21228326
3-[[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21228326) has the molecular formula C25H17BrCl2N2O4S and a molecular weight of 592.30 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21228326 |
| Molecular Formula | C25H17BrCl2N2O4S |
| Molecular Weight | 592.30 g/mol |
| Exact Mass | 589.95 |
| IUPAC Name | 3-[[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CN1C(=O)/C(=C/c2cc(Br)ccc2OCc2ccc(Cl)c(Cl)c2)S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H17BrCl2N2O4S/c1-30-23(31)22(35-25(30)29-18-4-2-3-15(11-18)24(32)33)12-16-10-17(26)6-8-21(16)34-13-14-5-7-19(27)20(28)9-14/h2-12H,13H2,1H3,(H,32,33)/b22-12-,29-25+ |
| InChIKey | NETIXHDANMTBCF-VRAFJUTDSA-N |
| XLogP | 7.27 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.30 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|