C26H20BrN3O7S — CID 21227804
3-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21227804) has the molecular formula C26H20BrN3O7S and a molecular weight of 598.43 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21227804 |
| Molecular Formula | C26H20BrN3O7S |
| Molecular Weight | 598.43 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | 3-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cccc(C(=O)O)c3)N(C)C2=O)cc(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H20BrN3O7S/c1-29-24(31)22(38-26(29)28-18-7-4-6-17(13-18)25(32)33)12-16-10-20(27)23(21(11-16)36-2)37-14-15-5-3-8-19(9-15)30(34)35/h3-13H,14H2,1-2H3,(H,32,33)/b22-12-,28-26+ |
| InChIKey | UNUPZYGQSOEPTI-ABEMJDBOSA-N |
| XLogP | 5.88 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.43 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|