C26H19I2N3O6S — CID 4764873
3-[[5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4764873) has the molecular formula C26H19I2N3O6S and a molecular weight of 755.33 g/mol. Its IUPAC name is 3-[[5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4764873 |
| Molecular Formula | C26H19I2N3O6S |
| Molecular Weight | 755.33 g/mol |
| Exact Mass | 754.91 |
| IUPAC Name | 3-[[5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2cc(I)c(OCc3cccc([N+](=O)[O-])c3)c(I)c2)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C26H19I2N3O6S/c1-2-30-24(32)22(38-26(30)29-18-7-4-6-17(13-18)25(33)34)12-16-10-20(27)23(21(28)11-16)37-14-15-5-3-8-19(9-15)31(35)36/h3-13H,2,14H2,1H3,(H,33,34)/b22-12?,29-26- |
| InChIKey | CIRRHASMAQAXJH-WDIVQETMSA-N |
| XLogP | 6.71 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.33 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|