C26H20ClN3O6S — CID 4764505
3-[[5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4764505) has the molecular formula C26H20ClN3O6S and a molecular weight of 537.98 g/mol. Its IUPAC name is 3-[[5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4764505 |
| Molecular Formula | C26H20ClN3O6S |
| Molecular Weight | 537.98 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 3-[[5-[[3-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2ccc(OCc3cccc([N+](=O)[O-])c3)c(Cl)c2)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C26H20ClN3O6S/c1-2-29-24(31)23(37-26(29)28-19-7-4-6-18(14-19)25(32)33)13-16-9-10-22(21(27)12-16)36-15-17-5-3-8-20(11-17)30(34)35/h3-14H,2,15H2,1H3,(H,32,33)/b23-13?,28-26- |
| InChIKey | LFMUBKPUPNOARM-IAFSXFINSA-N |
| XLogP | 6.15 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.98 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|