C21H17ClN2O6S — CID 4772187
3-[[5-[[4-(carboxymethoxy)-3-chlorophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4772187) has the molecular formula C21H17ClN2O6S and a molecular weight of 460.90 g/mol. Its IUPAC name is 3-[[5-[[4-(carboxymethoxy)-3-chlorophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[5-[[4-(carboxymethoxy)-3-chlorophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4772187 |
| Molecular Formula | C21H17ClN2O6S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 3-[[5-[[4-(carboxymethoxy)-3-chlorophenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2ccc(OCC(=O)O)c(Cl)c2)S/C1=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C21H17ClN2O6S/c1-2-24-19(27)17(9-12-6-7-16(15(22)8-12)30-11-18(25)26)31-21(24)23-14-5-3-4-13(10-14)20(28)29/h3-10H,2,11H2,1H3,(H,25,26)(H,28,29)/b17-9?,23-21- |
| InChIKey | AGORLUFPDNKZSG-VIUFSOTNSA-N |
| XLogP | 4.13 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|