C26H19FI2N2O4S — CID 4766322
4-[[3-ethyl-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4766322) has the molecular formula C26H19FI2N2O4S and a molecular weight of 728.32 g/mol. Its IUPAC name is 4-[[3-ethyl-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[3-ethyl-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4766322 |
| Molecular Formula | C26H19FI2N2O4S |
| Molecular Weight | 728.32 g/mol |
| Exact Mass | 727.91 |
| IUPAC Name | 4-[[3-ethyl-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)C(=Cc2cc(I)c(OCc3ccc(F)cc3)c(I)c2)S/C1=N\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H19FI2N2O4S/c1-2-31-24(32)22(36-26(31)30-19-9-5-17(6-10-19)25(33)34)13-16-11-20(28)23(21(29)12-16)35-14-15-3-7-18(27)8-4-15/h3-13H,2,14H2,1H3,(H,33,34)/b22-13?,30-26- |
| InChIKey | KEMJRRTYATUTKD-MKTDTUGESA-N |
| XLogP | 6.94 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.32 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|