C28H24BrN3O7S — CID 21227680
ethyl 4-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 21227680) has the molecular formula C28H24BrN3O7S and a molecular weight of 626.49 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 21227680 |
| Molecular Formula | C28H24BrN3O7S |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/S/C(=C\c3cc(Br)c(OCc4cccc([N+](=O)[O-])c4)c(OC)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C28H24BrN3O7S/c1-4-38-27(34)19-8-10-20(11-9-19)30-28-31(2)26(33)24(40-28)15-18-13-22(29)25(23(14-18)37-3)39-16-17-6-5-7-21(12-17)32(35)36/h5-15H,4,16H2,1-3H3/b24-15-,30-28+ |
| InChIKey | JVHKWTWDWJSAIW-CCWWSCKISA-N |
| XLogP | 6.36 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|