C28H24Br2N2O4S — CID 21227747
ethyl 4-[[(5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 21227747) has the molecular formula C28H24Br2N2O4S and a molecular weight of 644.39 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 21227747 |
| Molecular Formula | C28H24Br2N2O4S |
| Molecular Weight | 644.39 g/mol |
| Exact Mass | 641.98 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/S/C(=C\c3cc(Br)c(OCc4ccc(C)cc4)c(Br)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C28H24Br2N2O4S/c1-4-35-27(34)20-9-11-21(12-10-20)31-28-32(3)26(33)24(37-28)15-19-13-22(29)25(23(30)14-19)36-16-18-7-5-17(2)6-8-18/h5-15H,4,16H2,1-3H3/b24-15-,31-28+ |
| InChIKey | ZHWQNAJVTYVTMJ-HEDWIIGZSA-N |
| XLogP | 7.51 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.39 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|