C31H25BrN2O4S — CID 6208069
ethyl 4-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 6208069) has the molecular formula C31H25BrN2O4S and a molecular weight of 601.52 g/mol. Its IUPAC name is ethyl 4-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 6208069 |
| Molecular Formula | C31H25BrN2O4S |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | ethyl 4-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\S/C(=C/c3ccc(OCc4ccc5ccccc5c4)c(Br)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C31H25BrN2O4S/c1-3-37-30(36)23-11-13-25(14-12-23)33-31-34(2)29(35)28(39-31)18-20-9-15-27(26(32)17-20)38-19-21-8-10-22-6-4-5-7-24(22)16-21/h4-18H,3,19H2,1-2H3/b28-18+,33-31- |
| InChIKey | BDYDBXBHJDXTFW-ZISNPVPXSA-N |
| XLogP | 7.59 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|