C27H22Cl2N2O4S — CID 21228259
ethyl 4-[[(5Z)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 21228259) has the molecular formula C27H22Cl2N2O4S and a molecular weight of 541.46 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 21228259 |
| Molecular Formula | C27H22Cl2N2O4S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/S/C(=C\c3ccc(OCc4ccccc4Cl)c(Cl)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O4S/c1-3-34-26(33)18-9-11-20(12-10-18)30-27-31(2)25(32)24(36-27)15-17-8-13-23(22(29)14-17)35-16-19-6-4-5-7-21(19)28/h4-15H,3,16H2,1-2H3/b24-15-,30-27+ |
| InChIKey | LPRQNWUALJDXBY-MWYWWUJJSA-N |
| XLogP | 6.98 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|