C29H27ClN2O5S — CID 4765222
ethyl 4-[[5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4765222) has the molecular formula C29H27ClN2O5S and a molecular weight of 551.06 g/mol. Its IUPAC name is ethyl 4-[[5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4765222 |
| Molecular Formula | C29H27ClN2O5S |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | ethyl 4-[[5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/SC(=Cc3ccc(OCc4cccc(Cl)c4)c(OCC)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C29H27ClN2O5S/c1-4-35-25-16-19(9-14-24(25)37-18-20-7-6-8-22(30)15-20)17-26-27(33)32(3)29(38-26)31-23-12-10-21(11-13-23)28(34)36-5-2/h6-17H,4-5,18H2,1-3H3/b26-17?,31-29+ |
| InChIKey | WTRKWVMBAFGINR-WJQUAYRBSA-N |
| XLogP | 6.73 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|