C32H28N2O5S — CID 6210416
ethyl 4-[[(5E)-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 6210416) has the molecular formula C32H28N2O5S and a molecular weight of 552.65 g/mol. Its IUPAC name is ethyl 4-[[(5E)-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5E)-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 6210416 |
| Molecular Formula | C32H28N2O5S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | ethyl 4-[[(5E)-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\S/C(=C/c3ccc(OCc4ccc5ccccc5c4)c(OC)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C32H28N2O5S/c1-4-38-31(36)24-12-14-26(15-13-24)33-32-34(2)30(35)29(40-32)19-21-10-16-27(28(18-21)37-3)39-20-22-9-11-23-7-5-6-8-25(23)17-22/h5-19H,4,20H2,1-3H3/b29-19+,33-32- |
| InChIKey | RVFPGIYGVCDGOC-IAEVOFLSSA-N |
| XLogP | 6.84 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|