C29H26FIN2O5S — CID 6208709
ethyl 4-[[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 6208709) has the molecular formula C29H26FIN2O5S and a molecular weight of 660.51 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 6208709 |
| Molecular Formula | C29H26FIN2O5S |
| Molecular Weight | 660.51 g/mol |
| Exact Mass | 660.06 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/S/C(=C\c3cc(I)c(OCc4ccc(F)cc4)c(OCC)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C29H26FIN2O5S/c1-4-36-24-15-19(14-23(31)26(24)38-17-18-6-10-21(30)11-7-18)16-25-27(34)33(3)29(39-25)32-22-12-8-20(9-13-22)28(35)37-5-2/h6-16H,4-5,17H2,1-3H3/b25-16-,32-29+ |
| InChIKey | PGVFSIUYOOASJC-YLXXDCCASA-N |
| XLogP | 6.82 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.51 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|