C28H25FN2O5S — CID 4772053
methyl 4-[[5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4772053) has the molecular formula C28H25FN2O5S and a molecular weight of 520.58 g/mol. Its IUPAC name is methyl 4-[[5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4772053 |
| Molecular Formula | C28H25FN2O5S |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | methyl 4-[[5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOc1cc(C=C2S/C(=N/c3ccc(C(=O)OC)cc3)N(C)C2=O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H25FN2O5S/c1-4-35-24-15-19(7-14-23(24)36-17-18-5-10-21(29)11-6-18)16-25-26(32)31(2)28(37-25)30-22-12-8-20(9-13-22)27(33)34-3/h5-16H,4,17H2,1-3H3/b25-16?,30-28+ |
| InChIKey | PQLPTCGZIFJWGH-MJCXVZHXSA-N |
| XLogP | 5.82 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|