C29H25N3O5S — CID 4765278
methyl 4-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4765278) has the molecular formula C29H25N3O5S and a molecular weight of 527.60 g/mol. Its IUPAC name is methyl 4-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4765278 |
| Molecular Formula | C29H25N3O5S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | methyl 4-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOc1cc(C=C2S/C(=N/c3ccc(C(=O)OC)cc3)N(C)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C29H25N3O5S/c1-4-36-25-15-19(9-14-24(25)37-18-22-8-6-5-7-21(22)17-30)16-26-27(33)32(2)29(38-26)31-23-12-10-20(11-13-23)28(34)35-3/h5-16H,4,18H2,1-3H3/b26-16?,31-29+ |
| InChIKey | SPIYYWLUKFTLDF-OKKLIXRUSA-N |
| XLogP | 5.56 |
| TPSA | 101.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|