C30H27N3O5S — CID 4995119
methyl 3-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4995119) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is methyl 3-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4995119 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | methyl 3-[[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOc1cc(C=C2S/C(=N\c3cccc(C(=O)OC)c3)N(CC)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C30H27N3O5S/c1-4-33-28(34)27(39-30(33)32-24-12-8-11-21(17-24)29(35)36-3)16-20-13-14-25(26(15-20)37-5-2)38-19-23-10-7-6-9-22(23)18-31/h6-17H,4-5,19H2,1-3H3/b27-16?,32-30- |
| InChIKey | GNPKBOFXLUPLLS-DYPJRGJHSA-N |
| XLogP | 5.95 |
| TPSA | 101.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|