C23H20N2O6S — CID 124642327
methyl 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124642327) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124642327 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | methyl 2-[(5E)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)OC)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C23H20N2O6S/c1-3-30-19-10-15(11-20-22(27)25(23(28)32-20)13-21(26)29-2)8-9-18(19)31-14-17-7-5-4-6-16(17)12-24/h4-11H,3,13-14H2,1-2H3/b20-11+ |
| InChIKey | HJRRTIBUJJZGFF-RGVLZGJSSA-N |
| XLogP | 3.75 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|