C24H24N2O4S — CID 126026638
2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 126026638) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126026638 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-[[4-[(E)-[3-[(2S)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/SC(=O)N([C@@H](C)CC)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C24H24N2O4S/c1-4-16(3)26-23(27)22(31-24(26)28)13-17-10-11-20(21(12-17)29-5-2)30-15-19-9-7-6-8-18(19)14-25/h6-13,16H,4-5,15H2,1-3H3/b22-13+/t16-/m0/s1 |
| InChIKey | LQSWOJJOBGNCKL-QPNANDPSSA-N |
| XLogP | 5.37 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|