C23H19BrN2O6S — CID 1235669
methyl 2-[(5E)-5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 1235669) has the molecular formula C23H19BrN2O6S and a molecular weight of 531.38 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1235669 |
| Molecular Formula | C23H19BrN2O6S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | methyl 2-[(5E)-5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)OC)C2=O)c(Br)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C23H19BrN2O6S/c1-3-31-18-8-16(9-20-22(28)26(23(29)33-20)12-21(27)30-2)17(24)10-19(18)32-13-15-7-5-4-6-14(15)11-25/h4-10H,3,12-13H2,1-2H3/b20-9+ |
| InChIKey | QLRWJCXMONOAKK-AWQFTUOYSA-N |
| XLogP | 4.51 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|