C20H14Br2N2O4S — CID 126179909
2-[[(5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126179909) has the molecular formula C20H14Br2N2O4S and a molecular weight of 538.22 g/mol. Its IUPAC name is 2-[[(5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126179909 |
| Molecular Formula | C20H14Br2N2O4S |
| Molecular Weight | 538.22 g/mol |
| Exact Mass | 535.90 |
| IUPAC Name | 2-[[(5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccccc3C#N)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C20H14Br2N2O4S/c1-2-28-14-7-13(16(21)17(22)18(14)25)8-15-19(26)24(20(27)29-15)10-12-6-4-3-5-11(12)9-23/h3-8,25H,2,10H2,1H3/b15-8+ |
| InChIKey | MZPSPAOCDOEULH-OVCLIPMQSA-N |
| XLogP | 5.42 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.22 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|