C22H19BrN2O4S — CID 126174706
2-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126174706) has the molecular formula C22H19BrN2O4S and a molecular weight of 487.38 g/mol. Its IUPAC name is 2-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126174706 |
| Molecular Formula | C22H19BrN2O4S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 2-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | CCOc1cc(OCC)c(/C=C2/SC(=O)N(Cc3ccccc3C#N)C2=O)cc1Br |
| InChI | InChI=1S/C22H19BrN2O4S/c1-3-28-18-11-19(29-4-2)17(23)9-16(18)10-20-21(26)25(22(27)30-20)13-15-8-6-5-7-14(15)12-24/h5-11H,3-4,13H2,1-2H3/b20-10+ |
| InChIKey | RFGLIYINXWGKCO-KEBDBYFISA-N |
| XLogP | 5.35 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|