C20H15Br2IN2O5S — CID 126256608
2-[(5Z)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126256608) has the molecular formula C20H15Br2IN2O5S and a molecular weight of 682.13 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126256608 |
| Molecular Formula | C20H15Br2IN2O5S |
| Molecular Weight | 682.13 g/mol |
| Exact Mass | 679.81 |
| IUPAC Name | 2-[(5Z)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C20H15Br2IN2O5S/c1-2-30-13-7-10(16(21)17(22)18(13)27)8-14-19(28)25(20(29)31-14)9-15(26)24-12-5-3-11(23)4-6-12/h3-8,27H,2,9H2,1H3,(H,24,26)/b14-8- |
| InChIKey | LPNBKQDMLAGBAP-ZSOIEALJSA-N |
| XLogP | 5.60 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.13 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|