C18H11BrI2N2O4S — CID 126268330
2-[(5Z)-5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126268330) has the molecular formula C18H11BrI2N2O4S and a molecular weight of 685.08 g/mol. Its IUPAC name is 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126268330 |
| Molecular Formula | C18H11BrI2N2O4S |
| Molecular Weight | 685.08 g/mol |
| Exact Mass | 683.77 |
| IUPAC Name | 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc(Br)cc(I)c2O)C1=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C18H11BrI2N2O4S/c19-10-5-9(16(25)13(21)7-10)6-14-17(26)23(18(27)28-14)8-15(24)22-12-3-1-11(20)2-4-12/h1-7,25H,8H2,(H,22,24)/b14-6- |
| InChIKey | CXVFVAYFRLQCFV-NSIKDUERSA-N |
| XLogP | 5.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.08 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|