C19H14Br2N2O5S — CID 126267748
2-[(5Z)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126267748) has the molecular formula C19H14Br2N2O5S and a molecular weight of 542.21 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126267748 |
| Molecular Formula | C19H14Br2N2O5S |
| Molecular Weight | 542.21 g/mol |
| Exact Mass | 539.90 |
| IUPAC Name | 2-[(5Z)-5-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C\c3cc(Br)c(O)c(Br)c3O)C2=O)cc1 |
| InChI | InChI=1S/C19H14Br2N2O5S/c1-9-2-4-11(5-3-9)22-14(24)8-23-18(27)13(29-19(23)28)7-10-6-12(20)17(26)15(21)16(10)25/h2-7,25-26H,8H2,1H3,(H,22,24)/b13-7- |
| InChIKey | DDBLPLQUGXEGEF-QPEQYQDCSA-N |
| XLogP | 4.61 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|