C20H16Br2N2O5S — CID 126262508
2-[(5Z)-5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126262508) has the molecular formula C20H16Br2N2O5S and a molecular weight of 556.23 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126262508 |
| Molecular Formula | C20H16Br2N2O5S |
| Molecular Weight | 556.23 g/mol |
| Exact Mass | 553.91 |
| IUPAC Name | 2-[(5Z)-5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(Br)c(Br)c(/C=C2\SC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)c1O |
| InChI | InChI=1S/C20H16Br2N2O5S/c1-10-3-5-11(6-4-10)23-16(25)9-24-19(27)15(30-20(24)28)7-12-17(22)13(21)8-14(29-2)18(12)26/h3-8,26H,9H2,1-2H3,(H,23,25)/b15-7- |
| InChIKey | NTQDHPMSGSWFJQ-CHHVJCJISA-N |
| XLogP | 4.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|