C22H21BrN2O5S — CID 126189509
2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 126189509) has the molecular formula C22H21BrN2O5S and a molecular weight of 505.39 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126189509 |
| Molecular Formula | C22H21BrN2O5S |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(CC)cc3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C22H21BrN2O5S/c1-3-13-5-7-15(8-6-13)24-20(27)12-25-21(28)19(31-22(25)29)10-14-9-18(30-4-2)17(26)11-16(14)23/h5-11,26H,3-4,12H2,1-2H3,(H,24,27)/b19-10- |
| InChIKey | SYNUSCTVLPXLSC-GRSHGNNSSA-N |
| XLogP | 4.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|