C21H18BrClN2O5S — CID 126189168
2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 126189168) has the molecular formula C21H18BrClN2O5S and a molecular weight of 525.81 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126189168 |
| Molecular Formula | C21H18BrClN2O5S |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | 2-[(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(C)c(Cl)c3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C21H18BrClN2O5S/c1-3-30-17-6-12(14(22)9-16(17)26)7-18-20(28)25(21(29)31-18)10-19(27)24-13-5-4-11(2)15(23)8-13/h4-9,26H,3,10H2,1-2H3,(H,24,27)/b18-7- |
| InChIKey | PURJSQBRESNGLR-WSVATBPTSA-N |
| XLogP | 5.19 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|