C29H25BrCl2N2O6S — CID 126114093
2-[(5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126114093) has the molecular formula C29H25BrCl2N2O6S and a molecular weight of 680.40 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126114093 |
| Molecular Formula | C29H25BrCl2N2O6S |
| Molecular Weight | 680.40 g/mol |
| Exact Mass | 678.00 |
| IUPAC Name | 2-[(5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(OCC)c(OCc4ccc(Cl)cc4Cl)cc3Br)C2=O)cc1 |
| InChI | InChI=1S/C29H25BrCl2N2O6S/c1-3-38-21-9-7-20(8-10-21)33-27(35)15-34-28(36)26(41-29(34)37)12-18-11-24(39-4-2)25(14-22(18)30)40-16-17-5-6-19(31)13-23(17)32/h5-14H,3-4,15-16H2,1-2H3,(H,33,35)/b26-12+ |
| InChIKey | SYSDDHVVBFCQTD-RPPGKUMJSA-N |
| XLogP | 7.81 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.40 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|