C28H24Cl2N2O4S — CID 126338935
2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 126338935) has the molecular formula C28H24Cl2N2O4S and a molecular weight of 555.48 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126338935 |
| Molecular Formula | C28H24Cl2N2O4S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3OCc3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C28H24Cl2N2O4S/c1-17(2)18-8-11-22(12-9-18)31-26(33)15-32-27(34)25(37-28(32)35)13-19-5-3-4-6-24(19)36-16-20-7-10-21(29)14-23(20)30/h3-14,17H,15-16H2,1-2H3,(H,31,33)/b25-13+ |
| InChIKey | RVMXBHHQNDLZLG-DHRITJCHSA-N |
| XLogP | 7.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|