C26H25BrN2O4S — CID 126138515
2-[[5-bromo-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126138515) has the molecular formula C26H25BrN2O4S and a molecular weight of 541.47 g/mol. Its IUPAC name is 2-[[5-bromo-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[5-bromo-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126138515 |
| Molecular Formula | C26H25BrN2O4S |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 2-[[5-bromo-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC3CCCCC3)C2=O)c(Br)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H25BrN2O4S/c1-32-22-11-20(21(27)13-23(22)33-16-19-10-6-5-9-18(19)14-28)12-24-25(30)29(26(31)34-24)15-17-7-3-2-4-8-17/h5-6,9-13,17H,2-4,7-8,15-16H2,1H3/b24-12+ |
| InChIKey | ZBKQTFKHUBIMPI-WYMPLXKRSA-N |
| XLogP | 6.52 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|