C16H16BrNO6S — CID 126129555
2-[(5E)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126129555) has the molecular formula C16H16BrNO6S and a molecular weight of 430.28 g/mol. Its IUPAC name is 2-[(5E)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126129555 |
| Molecular Formula | C16H16BrNO6S |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | 2-[(5E)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCOc1cc(Br)c(/C=C2/SC(=O)N(CC(=O)O)C2=O)cc1OCC |
| InChI | InChI=1S/C16H16BrNO6S/c1-3-23-11-5-9(10(17)7-12(11)24-4-2)6-13-15(21)18(8-14(19)20)16(22)25-13/h5-7H,3-4,8H2,1-2H3,(H,19,20)/b13-6+ |
| InChIKey | AZJMCXGURKVWHR-AWNIVKPZSA-N |
| XLogP | 3.37 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|