C17H18BrNO7S — CID 126137104
2-[5-bromo-2-ethoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126137104) has the molecular formula C17H18BrNO7S and a molecular weight of 460.30 g/mol. Its IUPAC name is 2-[5-bromo-2-ethoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-ethoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126137104 |
| Molecular Formula | C17H18BrNO7S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 2-[5-bromo-2-ethoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCOC)C2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C17H18BrNO7S/c1-3-25-12-6-10(11(18)8-13(12)26-9-15(20)21)7-14-16(22)19(4-5-24-2)17(23)27-14/h6-8H,3-5,9H2,1-2H3,(H,20,21)/b14-7+ |
| InChIKey | UXKKRYGMQPSJCH-VGOFMYFVSA-N |
| XLogP | 2.99 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|