C24H26BrNO5S — CID 126252480
(5E)-5-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126252480) has the molecular formula C24H26BrNO5S and a molecular weight of 520.45 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126252480 |
| Molecular Formula | C24H26BrNO5S |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | (5E)-5-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCCOC)C2=O)c(Br)cc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H26BrNO5S/c1-4-30-20-12-18(13-22-23(27)26(24(28)32-22)10-5-11-29-3)19(25)14-21(20)31-15-17-8-6-16(2)7-9-17/h6-9,12-14H,4-5,10-11,15H2,1-3H3/b22-13+ |
| InChIKey | AOKUBGXSPSXCNQ-LPYMAVHISA-N |
| XLogP | 5.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|