C19H22BrNO7S — CID 126252837
ethyl 2-[5-bromo-2-methoxy-4-[(E)-[3-(3-methoxypropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126252837) has the molecular formula C19H22BrNO7S and a molecular weight of 488.36 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-methoxy-4-[(E)-[3-(3-methoxypropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-2-methoxy-4-[(E)-[3-(3-methoxypropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126252837 |
| Molecular Formula | C19H22BrNO7S |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | ethyl 2-[5-bromo-2-methoxy-4-[(E)-[3-(3-methoxypropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=C2/SC(=O)N(CCCOC)C2=O)cc1OC |
| InChI | InChI=1S/C19H22BrNO7S/c1-4-27-17(22)11-28-15-10-13(20)12(8-14(15)26-3)9-16-18(23)21(19(24)29-16)6-5-7-25-2/h8-10H,4-7,11H2,1-3H3/b16-9+ |
| InChIKey | KHKNUDMHIQEPPM-CXUHLZMHSA-N |
| XLogP | 3.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|