C16H16BrNO7S — CID 126138110
2-[5-bromo-2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126138110) has the molecular formula C16H16BrNO7S and a molecular weight of 446.28 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126138110 |
| Molecular Formula | C16H16BrNO7S |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COCCN1C(=O)S/C(=C/c2cc(OC)c(OCC(=O)O)cc2Br)C1=O |
| InChI | InChI=1S/C16H16BrNO7S/c1-23-4-3-18-15(21)13(26-16(18)22)6-9-5-11(24-2)12(7-10(9)17)25-8-14(19)20/h5-7H,3-4,8H2,1-2H3,(H,19,20)/b13-6+ |
| InChIKey | YBHYYSQQAJTQCD-AWNIVKPZSA-N |
| XLogP | 2.60 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|