C23H23BrN2O6S — CID 6531113
methyl 2-[5-bromo-2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 6531113) has the molecular formula C23H23BrN2O6S and a molecular weight of 535.42 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6531113 |
| Molecular Formula | C23H23BrN2O6S |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | methyl 2-[5-bromo-2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COCCN1C(=O)/C(=C/c2cc(OC)c(OCC(=O)OC)cc2Br)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C23H23BrN2O6S/c1-29-10-9-26-22(28)20(33-23(26)25-16-7-5-4-6-8-16)12-15-11-18(30-2)19(13-17(15)24)32-14-21(27)31-3/h4-8,11-13H,9-10,14H2,1-3H3/b20-12-,25-23+ |
| InChIKey | CZMQSEAZJQWFGJ-ROIOHNFESA-N |
| XLogP | 4.26 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|