C26H28N2O6S — CID 3382227
methyl 2-[2-methoxy-4-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetate (PubChem CID 3382227) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetate |
|---|---|
| PubChem CID | 3382227 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | methyl 2-[2-methoxy-4-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetate |
| SMILES | C=CCc1cc(C=C2S/C(=N/c3ccccc3)N(CCOC)C2=O)cc(OC)c1OCC(=O)OC |
| InChI | InChI=1S/C26H28N2O6S/c1-5-9-19-14-18(15-21(32-3)24(19)34-17-23(29)33-4)16-22-25(30)28(12-13-31-2)26(35-22)27-20-10-7-6-8-11-20/h5-8,10-11,14-16H,1,9,12-13,17H2,2-4H3/b22-16?,27-26+ |
| InChIKey | WBHKQCMJOZWIBK-OWCWSJLYSA-N |
| XLogP | 4.23 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|